BIOPEP-UWM: Report
| ID | 10562 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 346.3801 | Monoisotopic mass | 346.1636 | |
| IC50 : | 118.50 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lin Y.-H., Chen C.-A., Tsai J.-S., Chen G.-W. | |
| Title | |
| Preparation and identification of novel antihypertensive peptides from the in vitro gastrointestinal digestion of marine Cobia skin hydrolysates. Nutrients, 11, 1351, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C17H22N4O4/c1-9(15(22)21-10(2)17(24)25)20-16(23)13(18)7-11-8-19-14-6-4-3-5-12(11)14/h3-6,8-10,13,19H,7,18H2,1-2H3,(H,20,23)(H,21,22)(H,24,25)/t9-,10-,13-/m0/s1 InChIKey=BRBCKMMXKONBAA-KWBADKCTSA-N |
| Database reference: |
| CAS: Registry No 166601-51-0 ChEBI: ID 164398 ChemSpider: ID 57533541 EPA CompTox: ID DTXSID40776156 EROP-Moscow: ID E24867 J-GLOBAL: ID 200907017005266998 Metabolomics Workbench: ID 85856 Nikkaji: ID J1.938.216H PubChem: CID 71350349 |