BIOPEP-UWM: Report
| ID | 10563 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 461.5119 | Monoisotopic mass | 461.2057 | |
| IC50 : | 9.40 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lin Y.-H., Chen C.-A., Tsai J.-S., Chen G.-W. | |
| Title | |
| Preparation and identification of novel antihypertensive peptides from the in vitro gastrointestinal digestion of marine Cobia skin hydrolysates. Nutrients, 11, 1351, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C25H27N5O4/c1-14(26)23(31)29-21(10-15-12-27-19-8-4-2-6-17(15)19)24(32)30-22(25(33)34)11-16-13-28-20-9-5-3-7-18(16)20/h2-9,12-14,21-22,27-28H,10-11,26H2,1H3,(H,29,31)(H,30,32)(H,33,34)/t14-,21-,22-/m0/s1 InChIKey=CKIBTNMWVMKAHB-RWGOJESNSA-N |
| Database reference: |
| CAS: Registry No 59005-79-7 ChEBI: ID 158595 ChemSpider: ID 57529071 EPA CompTox: ID DTXSID90852075 EROP-Moscow: ID E24868 Metabolomics Workbench: ID 79413 PubChem: CID 71443245 |