BIOPEP-UWM: Report
| ID | 10568 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 576.6437 | Monoisotopic mass | 576.2478 | |
| IC50 : | 536.02 µM |
|||
| Bibliographic data: | |
| Authors | |
| Panyayai T., Sangsawad P., Pacharawongsakda E., Sawatdichaikul O., Tongsima S., Choowongkomon K. | |
| Title | |
| The potential peptides against angiotensin-I converting enzyme through a virtual tripeptide-constructing library. Comput. Biol. Chem., 77, 207-213, 2018 | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C33H32N6O4/c34-25(13-19-16-35-26-10-4-1-7-22(19)26)31(40)38-29(14-20-17-36-27-11-5-2-8-23(20)27)32(41)39-30(33(42)43)15-21-18-37-28-12-6-3-9-24(21)28/h1-12,16-18,25,29-30,35-37H,13-15,34H2,(H,38,40)(H,39,41)(H,42,43)/t25-,29-,30-/m0/s1 InChIKey=KRCAKIVDAFTTGJ-ARVREXMNSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8681) Bitter peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 343) |
| Database reference: |
| BindingDB: ID 50169218 BIOPEP-UWM database of bioactive peptides: ID 8681 BIOPEP-UWM database of sensory peptides and amino acids: ID 343 CAS: Registry No 59005-82-2 ChEMBL: ID CHEMBL434535 ChemSpider: ID 23257174 EPA CompTox: ID DTXSID80658740 EROP-Moscow: ID E24731 J-GLOBAL: ID 200907051053602855 Metabolomics Workbench: ID 86213 Nikkaji: ID J2.284.672H PubChem: CID 44398561 SureChEMBL: ID SCHEMBL9868128 |