BIOPEP-UWM: Report
| ID | 10569 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 503.5914 | Monoisotopic mass | 503.2525 | |
| IC50 : | 752.91 µM |
|||
| Bibliographic data: | |
| Authors | |
| Panyayai T., Sangsawad P., Pacharawongsakda E., Sawatdichaikul O., Tongsima S., Choowongkomon K. | |
| Title | |
| The potential peptides against angiotensin-I converting enzyme through a virtual tripeptide-constructing library. Comput. Biol. Chem., 77, 207-213, 2018 | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)O InChI=1S/C28H33N5O3/c1-3-17(2)26(16-34)33-28(36)25(13-19-15-31-24-11-7-5-9-21(19)24)32-27(35)22(29)12-18-14-30-23-10-6-4-8-20(18)23/h4-11,14-17,22,25-26,30-31H,3,12-13,29H2,1-2H3,(H,32,35)(H,33,36)/t17-,22-,25-,26+/m0/s1 InChIKey=CJGQMJSGJUHMOJ-VLGYIPKHSA-N |
| Database reference: |
| EROP-Moscow: ID E24732 |