BIOPEP-UWM: Report
| ID | 10573 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 4 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 585.6488 | Monoisotopic mass | 585.2579 | |
| IC50 : | 121.20 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wu C.-L., Ni Z.-F., Kuang X.-Y., Li M.-F., Zong M.-H., Fan X.-D., Lou W.-Y. | |
| Title | |
| Novel multitarget ACE inhibitory peptides from bovine colostrum immunoglobulin G: cellular transport, efficacy in regulating endothelial dysfunction, and network pharmacology studies. J. Agric. Food Chem., 72, 4155–4169, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CO)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C32H35N5O6/c33-24(15-20-9-3-1-4-10-20)29(39)37-28(19-38)31(41)35-26(17-22-18-34-25-14-8-7-13-23(22)25)30(40)36-27(32(42)43)16-21-11-5-2-6-12-21/h1-14,18,24,26-28,34,38H,15-17,19,33H2,(H,35,41)(H,36,40)(H,37,39)(H,42,43)/t24-,26-,27-,28-/m0/s1 InChIKey=WABSOSNLXNTNDB-VNNZRSTGSA-N Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |