BIOPEP-UWM: Report
| ID | 10585 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 457.5248 | Monoisotopic mass | 457.2431 | |
| IC50 : | 46.71 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wu N., Li P., Shuang Q., Wuhanqimuge | |
| Title | |
| Screening and molecular dynamics simulation of ACE inhibitory tripeptides derived from milk fermented with Lactobacillus delbrueckii QS306. Food Funct., 15, 2655-2667, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C22H31N7O4/c23-15(11-13-12-27-16-6-2-1-5-14(13)16)19(30)28-17(7-3-9-26-22(24)25)20(31)29-10-4-8-18(29)21(32)33/h1-2,5-6,12,15,17-18,27H,3-4,7-11,23H2,(H,28,30)(H,32,33)(H4,24,25,26)/t15-,17-,18-/m0/s1 InChIKey=VIWQOOBRKCGSDK-SZMVWBNQSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8611) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 8611 |