BIOPEP-UWM: Report
| ID | 10587 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 434.4882 | Monoisotopic mass | 434.2271 | |
| IC50 : | 89.56 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wu N., Li P., Shuang Q., Wuhanqimuge | |
| Title | |
| Screening and molecular dynamics simulation of ACE inhibitory tripeptides derived from milk fermented with Lactobacillus delbrueckii QS306. Food Funct., 15, 2655-2667, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C20H30N6O5/c21-14(11-12-5-7-13(27)8-6-12)17(28)25-15(3-1-9-24-20(22)23)18(29)26-10-2-4-16(26)19(30)31/h5-8,14-16,27H,1-4,9-11,21H2,(H,25,28)(H,30,31)(H4,22,23,24)/t14-,15-,16-/m0/s1 InChIKey=CRWOSTCODDFEKZ-JYJNAYRXSA-N |
| Database reference: |