BIOPEP-UWM: Report
| ID | 10589 |
| Name | Antibacterial peptide |
| sequence |
| Function: | |||
| Antibacterial | |||
| Number of residues | 11 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 1322.8028 | Monoisotopic mass | 1321.9759 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Bonvin E., Personne H., Paschoud T., Reusser J., Gan B.-H., Luscher A., Köhler T., van Delden C., Reymond J.-L. | |
| Title | |
| Antimicrobial peptide−peptoid hybrids with and without membrane disruption. ACS Infect. Dis., 9, 2593−2606, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N(CCCCN)CC(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N(CCCCN)CC(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N(CC(C)C)CC(=O)O InChI=1S/C66H127N15O12/c1-41(2)31-50(61(88)79-55(36-46(11)12)66(93)81(38-47(13)14)40-58(84)85)73-57(83)39-80(30-22-20-28-70)65(92)54(35-45(9)10)78-64(91)53(34-44(7)8)76-60(87)49(24-16-18-26-68)74-62(89)51(32-42(3)4)77-63(90)52(33-43(5)6)75-59(86)48(23-15-17-25-67)72-56(82)37-71-29-21-19-27-69/h41-55,71H,15-40,67-70H2,1-14H3,(H,72,82)(H,73,83)(H,74,89)(H,75,86)(H,76,87)(H,77,90)(H,78,91)(H,79,88)(H,84,85)/t48-,49-,50-,51-,52-,53-,54-,55-/m0/s1 InChIKey=VCFRUAHOULHTQV-SDBIROSVSA-N {G[3!L-m]} - N-Isobutylglycine (ID 221 in the BIOPEP-UWM repository of amino acids and modifications) |
| Database reference: |