BIOPEP-UWM: Report
| ID | 10603 |
| Name | Tubulin-tyrosine ligase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Tubulin-tyrosine ligase (EC 6.3.2.25) | |||
| Number of residues | 2 |
Activity code | ttl |
| Activity : | tubulin-tyrosine ligase inhibitor |
|||
| Chemical mass | 310.3018 | Monoisotopic mass | 310.1160 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Raybin D., Flavin M. | |
| Title | |
| Enzyme which specifically adds tyrosine to the alpha chain of tubulin. Biochemistry, 16, 2189-2194, 1977 | |
| Year | Source |
| 1977 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C14H18N2O6/c15-10(5-6-12(18)19)13(20)16-11(14(21)22)7-8-1-3-9(17)4-2-8/h1-4,10-11,17H,5-7,15H2,(H,16,20)(H,18,19)(H,21,22)/t10-,11-/m0/s1 InChIKey: YSWHPLCDIMUKFE-QWRGUYRKSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides Bitter peptide according to the BIOPEP database of sensory peptides and amino acids (ID 273) Umami peptide according to the BIOPEP database of sensory peptides and amino acids (ID 413) |
| Database reference: |
| AHTPDB: ID 1115; 2819; 3276; 3322; 3477; 3903; 4722; 5145; 6193; 6700 BIOPEP-UWM database of bioactive peptides: ID 7752; 8777 BIOPEP-UWM database of sensory peptides and amino acids: ID 273; 413 BRENDA: Ligand Glu-Tyr ChEBI: ID 73513 ChemSpider: ID 449883 PubChem: ID 515717 SATPdb: ID satpdb17435 ZINC: ID ZINC01605476 |