BIOPEP-UWM: Report
| ID | 10604 |
| Name | Tubulin-tyrosine ligase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Tubulin-tyrosine ligase (EC 6.3.2.25) | |||
| Number of residues | 2 |
Activity code | ttl |
| Activity : | tubulin-tyrosine ligase inhibitor |
|||
| Chemical mass | 252.2658 | Monoisotopic mass | 252.1106 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Raybin D., Flavin M. | |
| Title | |
| Enzyme which specifically adds tyrosine to the alpha chain of tubulin. Biochemistry, 16, 2189-2194, 1977 | |
| Year | Source |
| 1977 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides N[C@@]([H])(C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C12H16N2O4/c1-7(13)11(16)14-10(12(17)18)6-8-2-4-9(15)5-3-8/h2-5,7,10,15H,6,13H2,1H3,(H,14,16)(H,17,18)/t7-,10-/m0/s1 InChIKey=ALZVPLKYDKJKQU-XVKPBYJWSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) accoreding to the BIOPEP-UWM database of bioactive peptides (ID 3563) Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 7866) Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8765) |
| Database reference: |
| AHTPDB: ID 1127, 1268, 1365, 1414, 1500, 1877, 1889, 2650, 2686, 2744, 2977, 3004, 3072, 3175, 3211, 3469, 3757, 3787, 3894, 4068, 4444, 4493, 4670, 5138, 5583, 5719, 5782, 6208, 6472 AODB: ID AOPE0711 BindingDB: ID 50188523 BIOPEP-UWM database of bioactive peptide: ID 3563; 7866; 8765 BRENDA: Ligand Ala-Tyr CAS: Registry No 3061-88-9 ChEBI: ID 73395 ChEMBL: ID CHEMBL94016 Chemspider: ID 83903 DFBP: ID DFBPACEI0616, DFBPANHY0455, DFBPANHY0656, DFBPANHY0945, DFBPANOX0047, DFBPANOX0775, DFBPMUFU0141 ECHA: ID 221-305-7 EPA CompTox: ID DTXSID00184677 EROP-Moscow: ID E04098 FermFooDB: ID FMDB844, FMDB1996 FooDB: ID FDB111756 HMDB: ID HMDB0028699 J-GLOBAL: ID 200907058047799951 Metabolights: ID MTBLC73395 Metabolomics Workbench: ID 78674 Nikkaji: ID J80.626I NMRShiftDB: ID 60023645 PepLife: ID 1196 PlantPepDB: ID PPepDB_240 PubChem: CID 92946 Sabio-RK: ID 23225, 25527 SATPdb: ID satpdb10146 SureChEMBL: ID SCHEMBL2493049 ZINC: ID ZINC000002390894 |