BIOPEP-UWM: Report
| ID | 10613 |
| Name | Inhibitor of cytosol alanyl aminopeptidase |
| sequence |
| Function: | |||
| Inhibitor of cytosol alanyl aminopeptidase (EC 3.4.11.14) (MEROPS ID: M01.010) | |||
| Number of residues | 4 |
Activity code | caa |
| Activity : | inhibitor of cytosol alanyl aminopeptidase |
|||
| Chemical mass | 302.3260 | Monoisotopic mass | 302.1585 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Garner C.W., Behal F. J. | |
| Title | |
| Human liver alanine aminopeptidase. Inhibition by amino acids. Biochemistry, 14, 3208-3212, 1975 | |
| Year | Source |
| 1975 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C12H22N4O5/c1-5(13)9(17)14-6(2)10(18)15-7(3)11(19)16-8(4)12(20)21/h5-8H,13H2,1-4H3,(H,14,17)(H,15,18)(H,16,19)(H,20,21)/t5-,6-,7-,8-/m0/s1 InChIKey=ZHRZLXZJVUFLNY-XAMCCFCMSA-N Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) ) according to the BRENDA database Inhibitor of Dipeptidyl peptidase-III (DPP-III) (EC 3.4.14.4) (MEROPS ID: M49.001) according to the BIOPEP-UWM databasde of bioactive peptides (ID 9516); the BRENDA database |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9516 BRENDA: Ligand Ala-Ala-Ala-Ala ChEMBL: ID CHEMBL2074927 ChemIDplus: ID 926-79-4 ChemSpider: ID 4585993 CTD: ID 926-79-4 DrugPortal: Compound Alanyl-alanyl-alanyl-alanine eChemPortal: Compound N-L-Alanyl-N-L-alanyl-N-L-alanyl-L-alanin FDA SRS: ID YFI1804G4S J-GLOBAL: ID 200907084455104261 MolInstincs: Compound H-ALA-ALA-ALA-ALA-OH NIST Chemistry Webbook: Compound L-Alanine,N-[N-(N-L-alanyl-L-alanyl)-L-alanyl]- Nikkaji: ID J150.804K PubChem: CID 5478846 SDBS: ID MS-NW-9114 SureChEMBL: ID SCHEMBL9701067 ZINC: ID ZINC000002539571 |