BIOPEP-UWM: Report
| ID | 10614 |
| Name | Inhibitor of cytosol alanyl aminopeptidase |
| sequence |
| Function: | |||
| Inhibitor of cytosol alanyl aminopeptidase (EC 3.4.11.14) (MEROPS ID: M01.010) | |||
| Number of residues | 3 |
Activity code | caa |
| Activity : | inhibitor of cytosol alanyl aminopeptidase |
|||
| Chemical mass | 203.1953 | Monoisotopic mass | 203.0903 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Garner C.W., Behal F. J. | |
| Title | |
| Human liver alanine aminopeptidase. Inhibition by amino acids. Biochemistry, 14, 3208-3212, 1975 | |
| Year | Source |
| 1975 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)NCC(=O)N[C@@H](C)C(=O)O InChI=1S/C7H13N3O4/c1-4(7(13)14)10-6(12)3-9-5(11)2-8/h4H,2-3,8H2,1H3,(H,9,11)(H,10,12)(H,13,14)/t4-/m0/s1 InChIKey: CCQOOWAONKGYKQ-BYPYZUCNSA-N Inhibitor of citrulline uptake in yeasts according to ChEMBL database Sweet peptide according to the BIOPEP-UWM database of sensory peptides and amino acids: ID 252 |
| Database reference: |
| BIOPEP-UWM database of sensory peptides and amino acids: ID 252 BRENDA: Ligand Gly-Gly-Ala ChEBI: ID 73899 ChEMBL: ID CHEMBL1221830 ChemSpider: ID 5360515 PubChem: ID 6992377 ZINC: ID ZINC01575500 |