BIOPEP-UWM: Report
| ID | 10621 |
| Name | Glutamate carboxypeptidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Glutamate carboxypeptidase (EC 3.4.17.11) (MEROPS ID: M20.001) | |||
| Number of residues | 4 |
Activity code | gluc |
| Activity : | glutamate carboxypeptidase inhibitor |
|||
| Chemical mass | 324.2854 | Monoisotopic mass | 324.0953 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Goldman P., Levy C. C. | |
| Title | |
| Carboxypeptidase G: purification and properties. Proc. Natl. Acad. Sci. USA, 58, 1299-1306, 1967 | |
| Year | Source |
| 1967 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: C1=CC=CC=C1OC(=O)NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C14H16N2O7/c17-11(16-10(13(20)21)6-7-12(18)19)8-15-14(22)23-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,15,22)(H,16,17)(H,18,19)(H,20,21)/t10-/m0/s1 InChIKey=FUELWPXKCASJHW-JTQLQIEISA-N {H2CO3} - Carbonic acid (ID 228 in the BIOPEP-UWM repository of amino acids and modifications) {ph!} - Phenol as a precursor of N-terminal group (ID 239 in the BIOPEP-UWM repository of amino acids and modifications) |
| Database reference: |
| BRENDA: Ligand Benzyloxycarbonyl-Gly-Glu |