BIOPEP-UWM: Report
| ID | 10625 |
| Name | Glutamate carboxypeptidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Glutamate carboxypeptidase (EC 3.4.17.11) (MEROPS ID: M20.001) | |||
| Number of residues | 2 |
Activity code | gluc |
| Activity : | glutamate carboxypeptidase inhibitor |
|||
| Chemical mass | 260.2861 | Monoisotopic mass | 260.1367 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Goldman P., Levy C. C. | |
| Title | |
| Carboxypeptidase G: purification and properties. Proc. Natl. Acad. Sci. USA, 58, 1299-1306, 1967 | |
| Year | Source |
| 1967 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C11H20N2O5/c1-3-6(2)9(12)10(16)13-7(11(17)18)4-5-8(14)15/h6-7,9H,3-5,12H2,1-2H3,(H,13,16)(H,14,15)(H,17,18)/t6-,7-,9-/m0/s1 InChIKey=KTGFOCFYOZQVRJ-ZKWXMUAHSA-N Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides: ID 7827 Bitter peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 487); the ChEMBL database; the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 1701, 2987, 3033, 3113, 3280, 3356, 3437, 3867, 3946, 6730 BioPepDB: ID biopep00496 BIOPEP-UWM database of bioactive peptides: ID 7827 BIOPEP-UWM database of sensory peptides and amino acids: ID 487 BRENDA: Ligand Ile-Glu ChEBI: ID 137259 ChEMBL: ID CHEMBL436551 ChemSpider: ID 5373205 EROP-Moscow: ID E01850 FeptideDB: ID 7827 J-GLOBAL: ID 201407086499305160 Nikkaji: ID J3.318.463H PubChem: CID 7009625 SATPdb: ID satpdb19205 SureChEMBL: ID SCHEMBL12496193 |