BIOPEP-UWM: Report
| ID | 10626 |
| Name | Glutamate carboxypeptidase II inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Glutamate carboxypeptidase II (EC 3.4.17.21) (MEROPS ID: M28.010) | |||
| Number of residues | 3 |
Activity code | gluc2 |
| Activity : | glutamate carboxypeptidase II inhibitor |
|||
| Chemical mass | 303.2679 | Monoisotopic mass | 303.1062 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Robinson M. B., Blakely R. D., Couto R., Coyle J. T | |
| Title | |
| Hydrolysis of the brain dipeptide N-acetyl-L-aspartyl-L-glutamate. J. Biol. Chem., 262, 14498-14506, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: CC(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C11H17N3O7/c1-5(15)13-7(4-9(17)18)10(19)14-6(11(20)21)2-3-8(12)16/h6-7H,2-4H2,1H3,(H2,12,16)(H,13,15)(H,14,19)(H,17,18)(H,20,21)/t6-,7-/m0/s1 InChIKey=FHLVSJCMOXYPEY-BQBZGAKWSA-N {C2:0} - Acetic acid - N-terminal modification (ID 130 in the BIOPEP-UWM repository of amino acids and modifications) |
| Database reference: |
| BRENDA: Ligand N-Acetyl-Asp-Gln ChemSpider: ID 9897216 J-GLOBAL: ID 200907089808633591 Nikkaji: ID J862.461E PubChem: CID 11722500 SureChEMBL: ID SCHEMBL10793247 |