BIOPEP-UWM: Report
| ID | 10627 |
| Name | Glutamate carboxypeptidase II inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Glutamate carboxypeptidase II (EC 3.4.17.21) (MEROPS ID: M28.010) | |||
| Number of residues | 4 |
Activity code | gluc2 |
| Activity : | glutamate carboxypeptidase II inhibitor |
|||
| Chemical mass | 419.3399 | Monoisotopic mass | 419.1170 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Robinson M. B., Blakely R. D., Couto R., Coyle J. T | |
| Title | |
| Hydrolysis of the brain dipeptide N-acetyl-L-aspartyl-L-glutamate. J. Biol. Chem., 262, 14498-14506, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: CC(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(=O)O)C(=O)O InChI=1S/C15H21N3O11/c1-6(19)16-8(4-11(22)23)14(27)17-7(2-3-10(20)21)13(26)18-9(15(28)29)5-12(24)25/h7-9H,2-5H2,1H3,(H,16,19)(H,17,27)(H,18,26)(H,20,21)(H,22,23)(H,24,25)(H,28,29)/t7-,8-,9-/m0/s1 InChIKey=MUSWVJNGJMLAJU-CIUDSAMLSA-N {C2:0} - Acetic acid - N-terminal modification (ID 130 in the BIOPEP-UWM repository of amino acids and modifications) |
| Database reference: |
| BRENDA: Ligand N-Acetyl-Asp-Glu-Asp |