BIOPEP-UWM: Report
| ID | 10635 |
| Name | Glutamate carboxypeptidase II inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Glutamate carboxypeptidase II (EC 3.4.17.21) (MEROPS ID: M28.010) | |||
| Number of residues | 2 |
Activity code | gluc2 |
| Activity : | glutamate carboxypeptidase II inhibitor |
|||
| Chemical mass | 218.2066 | Monoisotopic mass | 218.0899 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Robinson M. B., Blakely R. D., Couto R., Coyle J. T | |
| Title | |
| Hydrolysis of the brain dipeptide N-acetyl-L-aspartyl-L-glutamate. J. Biol. Chem., 262, 14498-14506, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@H](C(=O)N[C@H](C(=O)O)CCC(=O)O)C InChI=1S/C8H14N2O5/c1-4(9)7(13)10-5(8(14)15)2-3-6(11)12/h4-5H,2-3,9H2,1H3,(H,10,13)(H,11,12)(H,14,15)/t4-,5-/m0/s1 InChIKey: VYZAGTDAHUIRQA-WHFBIAKZSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8758) Umami peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 349); the EROP-Moscow database |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 8758 BIOPEP-UWM database of sensory peptides and amino acids: ID 349 BRENDA: Ligand Ala-Glu CAS: Registry No 13187-90-1 ChEBI: ID 61565 ChEMBL: ID CHEMBL2074938 ChemIDplus: ID 013187901 ChemSpider: ID 114174 EPA CompTox: ID DTXSID70927376 EROP-Moscow: ID E01841 FooDB: ID FDB111746 Good Scents: ID rw1301381 HMDB: ID HMDB0028686 J-GLOBAL: ID 200907068879915582 KEGG: ID C20958 Metabolomics Workbench: ID 78662 Nikkaji: ID J81.565I PubChem: CID 128841 UniChem: ID 1104834 UNII: ID 8D40GXI4MA Wikidata: ID Q27131168 ZINC: ID ZINC02242980 |