BIOPEP-UWM: Report
| ID | 10637 |
| Name | Glutamate carboxypeptidase II inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Glutamate carboxypeptidase II (EC 3.4.17.21) (MEROPS ID: M28.010) | |||
| Number of residues | 2 |
Activity code | gluc2 |
| Activity : | glutamate carboxypeptidase II inhibitor |
|||
| Chemical mass | 248.1896 | Monoisotopic mass | 248.0641 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Robinson M. B., Blakely R. D., Couto R., Coyle J. T | |
| Title | |
| Hydrolysis of the brain dipeptide N-acetyl-L-aspartyl-L-glutamate. J. Biol. Chem., 262, 14498-14506, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactivie peptides SMILES: N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)O InChI=1S/C8H12N2O7/c9-3(1-5(11)12)7(15)10-4(8(16)17)2-6(13)14/h3-4H,1-2,9H2,(H,10,15)(H,11,12)(H,13,14)(H,16,17)/t3-,4-/m0/s1 InChIKey: FRYULLIZUDQONW-IMJSIDKUSA-N Sour peptide according to BIOPEP database of sensory peptides and amino acids (ID 238); Umami peptide according to BIOPEP database of sensory peptides and amino acids (ID 239) Salty peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 240) |
| Database reference: |
| BindingDB: ID 50169127 BIOPEP-UWM database of sensory peptides and amino acids: ID 238; 239; 240 BRENDA: Ligand Asp-Asp ChEBI: ID 73446 ChEMBL: ID CHEMBL17171 ChemSpider: ID 414197 PubChem: ID 471583 ZINC: ID ZINC01575288 |