BIOPEP-UWM: Report
| ID | 10640 |
| Name | Glutamate carboxypeptidase II inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Glutamate carboxypeptidase II (EC 3.4.17.21) (MEROPS ID: M28.010) | |||
| Number of residues | 2 |
Activity code | gluc2 |
| Activity : | glutamate carboxypeptidase II inhibitor |
|||
| Chemical mass | 276.2426 | Monoisotopic mass | 276.0953 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Robinson M. B., Blakely R. D., Couto R., Coyle J. T | |
| Title | |
| Hydrolysis of the brain dipeptide N-acetyl-L-aspartyl-L-glutamate. J. Biol. Chem., 262, 14498-14506, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@]([H])(CCC(=O)O)C(=O)N[C@]([H])(CCC(=O)O)C(=O)O InChI=1S/C10H16N2O7/c11-5(1-3-7(13)14)9(17)12-6(10(18)19)2-4-8(15)16/h5-6H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m1/s1 InChIKey=YZQCXOFQZKCETR-UWVGGRQHSA-N |
| Database reference: |
| RENDA: Ligand D-Glu-D-Glu ChemSpider: ID 5360713 J-GLOBAL: ID 200907006355881782 Nikkaji: ID J2.705.150B PubChem: CID 6992583 |