BIOPEP-UWM: Report
| ID | 10652 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 430.5391 | Monoisotopic mass | 430.2572 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Qi X., Guan K., Liu C., Chen H., Ma Y., Wang R. | |
| Title | |
| Whey protein peptides PEW and LLW synergistically ameliorate hyperuricemia and modulate gut microbiota in potassium oxonate and hypoxanthine-induced hyperuricemic rats, J. Dairy Sci., 106, 7367-7381, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C23H34N4O4/c1-13(2)9-17(24)21(28)26-19(10-14(3)4)22(29)27-20(23(30)31)11-15-12-25-18-8-6-5-7-16(15)18/h5-8,12-14,17,19-20,25H,9-11,24H2,1-4H3,(H,26,28)(H,27,29)(H,30,31)/t17-,19-,20-/m0/s1 InChIKey=FOBUGKUBUJOWAD-IHPCNDPISA-N Hypouricemic peptide according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |
| ChEBI: ID 159327 ChemSpider: ID 8108060 J-GLOBAL: ID 200907081474769534 Metabolomics Workbench: ID 83273 Nikkaji: ID J1.966.203I PubChem: CID 9932431 |