BIOPEP-UWM: Report
| ID | 10655 |
| Name | Glutamate carboxypeptidase II inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Glutamate carboxypeptidase II (EC 3.4.17.21) (MEROPS ID: M28.010) | |||
| Number of residues | 3 |
Activity code | gluc2 |
| Activity : | glutamate carboxypeptidase II inhibitor |
|||
| Chemical mass | 261.2313 | Monoisotopic mass | 261.0957 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Robinson M. B., Blakely R. D., Couto R., Coyle J. T. | |
| Title | |
| Hydrolysis of the brain dipeptide N-acetyl-L-aspartyl-L-glutamate. J. Biol. Chem., 262, 14498-14506, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C9H15N3O6/c10-3-6(13)11-4-7(14)12-5(9(17)18)1-2-8(15)16/h5H,1-4,10H2,(H,11,13)(H,12,14)(H,15,16)(H,17,18)/t5-/m0/s1 InChIKey=GDOZQTNZPCUARW-YFKPBYRVSA-N Antioxidative peptide according to the BIOPEP-UWM database bioactive peptides (ID 8114) |
| Database reference: |
| ACToR: ID 17343-05-4 BIOPEP-UWM database of bioactive peptides: ID 8114 BRENDA: Ligand Gly-Gly-Glu ChEBI: ID 163692 ChEMBL: ID CHEMBL1221829 ChemSpider: ID 5360627 J-GLOBAL: ID 200907034410939080 Metabolomics Workbench: ID 82002 Nikkaji: ID J346.818F PubChem: CID 6992497 ZINC: ID ZINC000001576189 |