BIOPEP-UWM: Report
| ID | 10657 |
| Name | Glutathione – antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 307.3239 | Monoisotopic mass | 307.0834 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Torres P., Galleguillos P., Lissi E., López-Alarcón C. | |
| Title | |
| Antioxidant capacity of human blood plasma and human urine: simultaneous evaluation of the ORAC index and ascorbic acid concentration employing pyrogallol red as probe. Bioorg. Med. Chem., 16, 9171-9175, 2008 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@]([H])(C(=O)O)CCC(=O)N[C@@]([H])(CS)C(=O)NCC(=O)O InChI=1S/C10H17N3O6S/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1 InChIKey=RWSXRVCMGQZWBV-WDSKDSINSA-N {E;5} - glutamic acid bound via γ-carboxyl group (ID 77 in the BIOPEP-UWM repository of amino acids and modifications) Inhibitor of Glutamate carboxypeptidase II (EC 3.4.17.21) (MEROPS ID: M28.010) according to the BIOPEP-UWM database of bioactive peptides; the BRENDA database |
| Database reference: |
| BiGG: ID 33669 BindingDB: ID 50422268 BioCyc: Compound GLUTATHIONE Brenda: Ligand Glutathione CAS: Registry No 70-18-8 ChEBI: ID 16856 ChEMBL: ID CHEMBL1543 Chemspider: ID 111188 DrugBank: ID DB00143 DrugCentral: ID 1312 ECHA: ID 200-725-4 EPA CompTox: ID DTXSID6023101 EROP-Moscow: ID E03922 FDA SRS: ID GAN16C9B8O FooDB: ID FDB001498 Guide to Pharmacology: ID 6737 HMDB: ID HMDB0000125 J-GLOBAL: ID 200907050768514817 KEGG: ID C02471 KNApSAcK: ID C00001518 MarkerDB: ID MDB00000060 Metabolights: ID MTBLC16856 Metabolomics Workbench: ID 37087 METLIN: ID 44 Nikkaji: ID J10.686K NMRShiftDB: ID 60020798 NSC: ID 758199 PDBe: ID GSH Pharos Ligand: ID 82VDMK4PDWYL ProbesDrugs: ID PD001337 PubChem: CID 124886 SureChEMBL: ID SCHEMBL9167 UNII: ID GAN16C9B8O ZINC: ID ZINC000003830891 |