BIOPEP-UWM: Report
| ID | 10678 |
| Name | Hypouricemic peptide |
| sequence |
| Function: | |||
| Hypouricemic activity in vivo in rats | |||
| Number of residues | 10 |
Activity code | hur |
| Activity : | hypouricemic |
|||
| Chemical mass | 1158.2557 | Monoisotopic mass | 1157.5908 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Qi X., Chen H., Guan K., Wang R., Ma Y. | |
| Title | |
| Anti-hyperuricemic and nephroprotective effects of whey protein hydrolysate in potassium oxonate induced hyperuricemic rats. J. Sci. Food Agric., 101, 4916–4924, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C49H83N13O19/c1-7-22(3)36(45(76)57-30(49(80)81)20-33(53)66)58-47(78)39(25(6)64)61-44(75)31-13-11-19-62(31)48(79)37(23(4)8-2)59-42(73)28(15-17-34(67)68)55-46(77)38(24(5)63)60-41(72)27(12-9-10-18-50)54-43(74)29(21-35(69)70)56-40(71)26(51)14-16-32(52)65/h22-31,36-39,63-64H,7-21,50-51H2,1-6H3,(H2,52,65)(H2,53,66)(H,54,74)(H,55,77)(H,56,71)(H,57,76)(H,58,78)(H,59,73)(H,60,72)(H,61,75)(H,67,68)(H,69,70)(H,80,81)/t22-,23-,24+,25+,26-,27-,28-,29-,30-,31-,36-,37-,38-,39-/m0/s1 InChIKey=ZPIPDXBGGXPZTP-ILOQSHFYSA-N |
| Database reference: |
| AHTPDB: ID 1103, 1532, 4760, 5084, 5249, 6182 BioPepDB: ID biopep01229 BIOPEP-UWM database of bioactive peptides: ID 9030 BIOPEP-UWM Virtual database: ID 53 BRENDA: Ligand Arg-Val-Tyr CAS: Registry No 76509-57-4 ChEBI: ID 159470 ChemSpider ID: 13164586 DFBP: ID DFBPACEI0008; DFBPANOX0859; DFBPMUFU0002 EPA DSSTox: ID DTXCID10531936 EROP-Moscow: ID E01341 Metabolomics Workbench: ID 79854 PubChem: CID 16035988 SATPdb: ID satpdb24293 |