BIOPEP-UWM: Report
| ID | 10688 |
| Name | Hypouricemic peptide |
| sequence |
| Function: | |||
| Hypouricemic activity in vivo in rats | |||
| Number of residues | 10 |
Activity code | hur |
| Activity : | hypouricemic |
|||
| Chemical mass | 1084.2616 | Monoisotopic mass | 1083.5945 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Qi X., Chen H., Guan K., Wang R., Ma Y. | |
| Title | |
| Anti-hyperuricemic and nephroprotective effects of whey protein hydrolysate in potassium oxonate induced hyperuricemic rats. J. Sci. Food Agric., 101, 4916–4924, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C52H81N11O14/c1-26(2)39(57-45(69)35-18-13-23-62(35)51(75)42(30(8)65)60-43(67)32(20-21-37(53)66)55-46(70)38(54)29(7)64)47(71)58-40(27(3)4)48(72)59-41(28(5)6)50(74)63-24-14-19-36(63)49(73)61-22-12-17-34(61)44(68)56-33(52(76)77)25-31-15-10-9-11-16-31/h9-11,15-16,26-30,32-36,38-42,64-65H,12-14,17-25,54H2,1-8H3,(H2,53,66)(H,55,70)(H,56,68)(H,57,69)(H,58,71)(H,59,72)(H,60,67)(H,76,77)/t29-,30-,32+,33+,34+,35+,36+,38+,39+,40+,41+,42+/m1/s1 InChIKey=JOWOGMGOEFRMAU-RHXKIISDSA-N |
| Database reference: |