BIOPEP-UWM: Report
| ID | 10690 |
| Name | Hypouricemic peptide |
| sequence |
| Function: | |||
| Hypouricemic activity in vivo in rats | |||
| Number of residues | 8 |
Activity code | hur |
| Activity : | hypouricemic |
|||
| Chemical mass | 997.1449 | Monoisotopic mass | 996.5376 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Qi X., Chen H., Guan K., Wang R., Ma Y. | |
| Title | |
| Anti-hyperuricemic and nephroprotective effects of whey protein hydrolysate in potassium oxonate induced hyperuricemic rats. J. Sci. Food Agric., 101, 4916–4924, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C47H72N12O12/c1-5-27(4)39(45(68)56-34(22-29-24-51-25-52-29)46(69)59-19-11-15-36(59)44(67)57-35(47(70)71)21-28-12-7-6-8-13-28)58-42(65)31(14-9-10-18-48)54-43(66)33(23-38(61)62)55-41(64)32(16-17-37(50)60)53-40(63)30(49)20-26(2)3/h6-8,12-13,24-27,30-36,39H,5,9-11,14-23,48-49H2,1-4H3,(H2,50,60)(H,51,52)(H,53,63)(H,54,66)(H,55,64)(H,56,68)(H,57,67)(H,58,65)(H,61,62)(H,70,71)/t27-,30-,31-,32-,33-,34-,35-,36-,39-/m0/s1 InChIKey=ZSZMRSMPVGNNLA-BOSBWABNSA-N |
| Database reference: |