BIOPEP-UWM: Report
| ID | 10693 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative peptide | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1267.4688 | Monoisotopic mass | 1266.6950 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang A., Cui L., Tu X., Yu Liang Y., Wang C., Sun Y., Kang X., Wu Z. | |
| Title | |
| Peptides derived from casein hydrolyzed by Lactobacillus: Screening and antioxidant properties in H2O2-induced HepG2 cells model. J. Funct. Foods, 117, 106221, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C60H94N14O16/c1-31(2)24-43(71-51(81)39(61)28-35-11-15-37(75)16-12-35)52(82)66-30-49(78)67-47(29-36-13-17-38(76)18-14-36)58(88)74-44(25-32(3)4)55(85)69-41(20-22-50(79)80)53(83)68-40(19-21-48(62)77)54(84)72-46(27-34(7)8)57(87)73-45(26-33(5)6)56(86)70-42(59(89)90)10-9-23-65-60(63)64/h11-18,31-34,39-47,75-76H,9-10,19-30,61H2,1-8H3,(H2,62,77)(H,66,82)(H,67,78)(H,68,83)(H,69,85)(H,70,86)(H,71,81)(H,72,84)(H,73,87)(H,74,88)(H,79,80)(H,89,90)(H4,63,64,65)/t39-,40-,41-,42-,43-,44-,45-,46-,47-/m0/s1 InChIKey=SKGURMFKEAFAGD-CSYZDTNESA-N Neuropeptide according to the BIOPEP-UWM database of bioactive peptides (ID 8339); the EROP-Moscow database; the MBPDB database; teh PepBank database; the PubChem database |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 8339 CAS: Registry No 117592-45-7 ChemSpider: ID 8526885 EROP-Moscow: ID E14687 J-GLOBAL: ID 200907044457621636 MBPDB: Peptide YLGYLEQLLR MESH: term alpha-casozepine Nikkaji: ID J2.132.983E PepBank: Peptide YLGYLEQLLR PubChem: CID 10351433 SureChEMBL: ID SCHEMBL22413050 UNII: ID I24KIH8EZS |