BIOPEP-UWM: Report
| ID | 10694 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative peptide | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1251.4694 | Monoisotopic mass | 1250.7001 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang A., Cui L., Tu X., Yu Liang Y., Wang C., Sun Y., Kang X., Wu Z. | |
| Title | |
| Peptides derived from casein hydrolyzed by Lactobacillus: Screening and antioxidant properties in H2O2-induced HepG2 cells model. J. Funct. Foods, 117, 106221, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C60H94N14O15/c1-9-33(7)48(72-55(84)45-14-12-26-74(45)58(87)49(34(8)10-2)73-50(79)39(61)28-35-15-19-37(76)20-16-35)57(86)66-40(23-24-46(62)78)51(80)68-43(29-36-17-21-38(77)22-18-36)53(82)71-47(32(5)6)56(85)69-42(27-31(3)4)52(81)70-44(30-75)54(83)67-41(59(88)89)13-11-25-65-60(63)64/h15-22,31-34,39-45,47-49,75-77H,9-14,23-30,61H2,1-8H3,(H2,62,78)(H,66,86)(H,67,83)(H,68,80)(H,69,85)(H,70,81)(H,71,82)(H,72,84)(H,73,79)(H,88,89)(H4,63,64,65)/t33-,34-,39-,40-,41-,42-,43-,44-,45-,47-,48-,49-/m0/s1 InChIKey=FLMZYYASMMUDFC-FJKDSYQFSA-N Opioid antagonist according to the BIOPEP-UWM database of bioactive peptides (ID 3215); the EROP-Moscow database; the MBPDB database; the PubChem database Ileum contracting peptide according to the BIOPEP-UWM database of bioactive peptides (ID 3216); the EROP-Moscow database; the MBPDB database; the PubChem database |
| Database reference: |
| AHTPDB: ID 1209, 2459, 5861, 6414 BioPepDB: ID biopep01572; biopep04753 BIOPEP-UWM database of bioactive peptides: ID 3215; 3216 ChemSpider: ID 77431544 EROP-Moscow: ID E02135 IUPHAR BPS: ID 10224 J-GLOBAL: ID 200907053787968585 MBPDB: peptide YIPIQYVLSR Nikkaji: ID J448.895D PepBank: peptide YIPIQYVLSR PubChem: CID: 25254550 SATPdb: ID satpdb17846 |