BIOPEP-UWM: Report
| ID | 10695 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 373.4895 | Monoisotopic mass | 373.2681 | |
| IC50 : | 1045.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Tsai J. S., Lin T. C., Chen J. L., Pan B. S. | |
| Title | |
| The inhibitory effects of freshwater clam (Corbicula fluminea, Muller) muscle protein hydrolysates on angiotensin I converting enzyme. Process Biochem., 41, 2276-2281, 2006 | |
| Year | Source |
| 2006 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C17H35N5O4/c1-11(2)14(20)16(24)21-12(7-3-5-9-18)15(23)22-13(17(25)26)8-4-6-10-19/h11-14H,3-10,18-20H2,1-2H3,(H,21,24)(H,22,23)(H,25,26)/t12-,13-,14-/m0/s1 InChIKey=YMTOEGGOCHVGEH-IHRRRGAJSA-N Activator of Angiotensin 2-converting enzyme (ACE2) (EC 3.4.17.23) (MEROPS ID: M02.006) according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |
| AHTPDB: ID 2817, 3697, 4787, 5258, 5739 ChEBI: ID 166286 EROP-Moscow: ID E23528 Metabolomics Workbench: ID 86887 PubChem: CID 53340373 SATPdb: ID satpdb25587 |