BIOPEP-UWM: Report
| ID | 10697 |
| Name | ACE 2 activator |
| sequence |
| Function: | |||
| Activator of Angiotensin 2-converting enzyme (ACE2) (EC 3.4.17.23) (MEROPS ID: M02.006) | |||
| Number of residues | 3 |
Activity code | aac2 |
| Activity : | ACE 2 activator |
|||
| Chemical mass | 356.4591 | Monoisotopic mass | 356.2416 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang Z., Fan H., Bao X., Wu J. | |
| Title | |
| Angiotensin-converting enzyme 2 activation is not a common feature of angiotensin-converting enzyme inhibitory peptides. J. Agric. Food Chem., 71, 8867−8876, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C17H32N4O4/c1-11(2)10-12(19)15(22)20-13(6-3-4-8-18)16(23)21-9-5-7-14(21)17(24)25/h11-14H,3-10,18-19H2,1-2H3,(H,20,22)(H,24,25)/t12-,13-,14-/m0/s1 InChIKey: RTIRBWJPYJYTLO-IHRRRGAJSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BindingDB database; the BIOPEP-UWM database of bioactive peptides (ID 7549); the BRENDA database; the ChEMBL database; the DFBP database; the PlanPepDB database; the PubChem database Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 8216); the DFBP database |
| Database reference: |
| AHTPDB: ID 1073, 1521, 1528, 1611, 1660, 1838, 1953, 1969, 1972, 2001, 2002, 2020, 2025, 2216, 2597, 2861, 2892, 2945, 2952, 3011, 3758, 3766, 3770, 3979, 4203, 4222, 4976, 4979, 5059, 5513, 5561, 6535 BindingDB: ID 50348861 BIOPEP-UWM database of bioactive peptide: ID 7549; 8216 BRENDA: Ligand Leu-Lys-Pro ChEMBL: ID CHEMBL1807676 ChemSpider: ID 8648888 DFBP: ID DFBPACEI0017; DFBPANHY0513; DFBPANOX0783; DFBPANOX0865; DFBPMUFU0008 EROP-Moscow: ID E01438 J-GLOBAL: ID 200907022084757598 Nikkaji: ID J1.356.196F PlantPepDB: ID PPepDB_118 PubChem: CID 10473477 SATPdb: ID satpdb17881 SureChEMBL: ID SCHEMBL7757715 ZINC: ID ZINC000038930594 |