BIOPEP-UWM: Report
| ID | 10705 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 9 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 1029.2724 | Monoisotopic mass | 1028.6363 | |
| IC50 : | 15.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Robert M. C., Razaname A., Mutter M., Juillerat M. A. | |
| Title | |
| Identification of angiotensin-I-converting enzyme inhibitory peptides derived from sodium caseinate hydrolysates produced by Lactobacillus helveticus NCC 2765. J. Agric. Food. Chem., 52, 6923-6931, 2004 | |
| Year | Source |
| 2004 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C50H84N12O11/c1-26(2)17-33(55-42(64)32(51)23-41(52)63)43(65)56-35(22-31-24-53-25-54-31)45(67)58-36(19-28(5)6)48(70)62-16-12-14-40(62)47(69)59-37(20-29(7)8)49(71)61-15-11-13-39(61)46(68)57-34(18-27(3)4)44(66)60-38(50(72)73)21-30(9)10/h24-30,32-40H,11-23,51H2,1-10H3,(H2,52,63)(H,53,54)(H,55,64)(H,56,65)(H,57,68)(H,58,67)(H,59,69)(H,60,66)(H,72,73)/t32-,33-,34-,35-,36-,37-,38-,39-,40-/m0/s1 InChIKey=PLSNHYPQMRIMOR-LCQMPJFHSA-N Anticancer peptide according to the BIOPEP-UWM database of bioactive peptides (ID 8315), the DFBP database |
| Database reference: |
| AHTPDB: ID 1773, 6069 BIOPEP-UWM database of bioactive peptides: ID 8315 ChemSpider: ID 9941237 DFBP: ID DFBPACEI1436; DFBPANCA0092; DFBPANCA0107; DFBPMUFU0380 EROP-Moscow: ID E09174 MBPDB: Peptide NLHLPLPLL PubChem: CID 11766550 SATPdb: ID satpdb22978 |