BIOPEP-UWM: Report
| ID | 10706 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 10 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 1158.3861 | Monoisotopic mass | 1157.6787 | |
| IC50 : | 250.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Robert M. C., Razaname A., Mutter M., Juillerat M. A. | |
| Title | |
| Identification of angiotensin-I-converting enzyme inhibitory peptides derived from sodium caseinate hydrolysates produced by Lactobacillus helveticus NCC 2765. J. Agric. Food. Chem., 52, 6923-6931, 2004 | |
| Year | Source |
| 2004 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C55H91N13O14/c1-28(2)19-35(61-50(76)38(25-44(57)69)60-46(72)34(56)15-16-45(70)71)47(73)62-37(24-33-26-58-27-59-33)49(75)64-39(21-30(5)6)53(79)68-18-12-14-43(68)52(78)65-40(22-31(7)8)54(80)67-17-11-13-42(67)51(77)63-36(20-29(3)4)48(74)66-41(55(81)82)23-32(9)10/h26-32,34-43H,11-25,56H2,1-10H3,(H2,57,69)(H,58,59)(H,60,72)(H,61,76)(H,62,73)(H,63,77)(H,64,75)(H,65,78)(H,66,74)(H,70,71)(H,81,82)/t34-,35-,36-,37-,38-,39-,40-,41-,42-,43-/m0/s1 InChIKey=DTXZRWJTBCMKMM-IJXJCFDCSA-N Anticancer peptide according to the BIOPEP-UWM database of bioactive peptides (ID 8316), the DFBP database |
| Database reference: |
| AHTPDB: ID 6947 BIOPEP-UWM database of bioactive peptides ID 8316 DFBP: ID DFBPACEI1437; DFBPANCA0108; DFBPMUFU0381 EROP-Moscow: ID E09175 MBPDB: Peptide ENLHLPLPLL SATPdb: ID satpdb25789 |