BIOPEP-UWM: Report
| ID | 10720 |
| Name | Neprilysin inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Neprilysin (EC 3.4.24.11) (MEROPS ID: M13.008) | |||
| Number of residues | 2 |
Activity code | nep |
| Activity : | neprilysin inhibitor |
|||
| Chemical mass | 351.3982 | Monoisotopic mass | 351.1578 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Dion N., Cohen P., Crine P., Boileau G. | |
| Title | |
| Characterisation of neprilysin (EC 3.4.24.11) S2 subsite. FEBS Lett., 411, 140-144, 1997 | |
| Year | Source |
| 1997 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C15H23N5O3/c16-11(9-10-5-2-1-3-6-10)13(21)20-12(14(22)23)7-4-8-19-15(17)18/h1-3,5-6,11-12H,4,7-9,16H2,(H,20,21)(H,22,23)(H4,17,18,19)/t11-,12-/m0/s1 InChIKey=OZILORBBPKKGRI-RYUDHWBXSA-N InChI=1S/C20H21N3O3/c21-16(10-13-6-2-1-3-7-13)19(24)23-18(20(25)26)11-14-12-22-17-9-5-4-8-15(14)17/h1-9,12,16,18,22H,10-11,21H2,(H,23,24)(H,25,26)/t16-,18-/m0/s1 InChIKey: JMCOUWKXLXDERB-WMZOPIPTSA-N Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) according to AHTPDB database; the BindingDB database; the BIOPEP-UWM database of bioactive peptides; the DFBP database; the PlantPepDB database Development regulating peptide from hydra according to the EROP-Moscow database Hypouricemic peptide according to the BIOPEP-UWM database of bioactive peptides Bitter peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 339); the BitterDB database |
| Database reference: |
| AHTPDB: ID 1990; 2005; 2037 BIOPEP-UWM database of sensory peptides and amino acids: ID 339 BitterDB: ID 829 BRENDA: Ligand Phe-Trp CAS: Registry No 24587-41-5 ChEBI: ID 74751 ChemIDplus: ID 024587415 ChemSpider: ID 118886 DFBP: ID DFBPACEI1985 EPA CompTox: ID DTXSID00947461 EROP-Moscow: ID E02335 FooDB: ID FDB112022 HMDB: ID HMDB0029006 J-GLOBAL: ID 200907074334077539 MeSH: terms Phe-Trp; phenylalanyltryptophan Metabolomics Workbench: ID 78933 Nikkaji: ID J61.746F PlantPepDB: ID PPepDB_48 PMhub: ID MS000238150 PubChem: ID 134906 SATPdb: ID satpdb16434 SureChEMBL: ID SCHEMBL2182648 UNII: ID 7G2SCL87C5 ZINC: ID ZINC02575127 |