BIOPEP-UWM: Report
| ID | 10723 |
| Name | Hypouricemic peptide |
| sequence |
| Function: | |||
| Hypouricemic activity in vivo in rats | |||
| Number of residues | 3 |
Activity code | hur |
| Activity : | hypouricemic |
|||
| Chemical mass | 464.5554 | Monoisotopic mass | 464.2416 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| He W., Su G., Sun-Waterhouse D., Waterhouse G. I., Zhao M., Liu Y. | |
| Title | |
| In vivo anti-hyperuricemic and xanthine oxidase inhibitory properties of tuna protein hydrolysates and its isolated fractions. Food Chem., 272, 453–461, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C26H32N4O4/c1-16(2)12-20(27)24(31)29-22(13-17-8-4-3-5-9-17)25(32)30-23(26(33)34)14-18-15-28-21-11-7-6-10-19(18)21/h3-11,15-16,20,22-23,28H,12-14,27H2,1-2H3,(H,29,31)(H,30,32)(H,33,34)/t20-,22-,23-/m0/s1 InChIKey=MAXILRZVORNXBE-PMVMPFDFSA-N Analgesic peptide according to the BIOPEP-UWM database of bioactive peptides, the ChEMBL database |
| Database reference: |
| ChEBI: ID 159437 ChEMBL: ID CHEMBL1782873 ChemSpider: ID 26399113 Metabolomics Workbench: ID 83333 PubChem: CID 54584204 ZINC: ID ZINC000039796552 |