BIOPEP-UWM: Report
| ID | 10726 |
| Name | Analgesic peptide |
| sequence |
| Function: | |||
| Analgesic peptide | |||
| Number of residues | 3 |
Activity code | ne |
| Activity : | neuropeptide |
|||
| Chemical mass | 464.5554 | Monoisotopic mass | 464.2416 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Bi W., Bi Y., Xue P., Zhang Y., Gao X., Wang Z., Li M., Baudy-Floc'h M., Ngerebara N., Li X., Gibson K. M., Bi L. | |
| Title | |
| Novel β-carboline-tripeptide conjugates attenuate mesenteric ischemia/reperfusion injury in the rat. Eur. J. Med. Chem., 46, 2441-2452, 2011 | |
| Year | Source |
| 2011 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C26H32N4O4/c1-16(2)12-20(27)24(31)29-22(13-17-8-4-3-5-9-17)25(32)30-23(26(33)34)14-18-15-28-21-11-7-6-10-19(18)21/h3-11,15-16,20,22-23,28H,12-14,27H2,1-2H3,(H,29,31)(H,30,32)(H,33,34)/t20-,22-,23-/m0/s1 InChIKey=MAXILRZVORNXBE-PMVMPFDFSA-N Hypouricemic peptide according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |
| ChEBI: ID 159437 ChEMBL: ID CHEMBL1782873 ChemSpider: ID 26399113 Metabolomics Workbench: ID 83333 PubChem: CID 54584204 ZINC: ID ZINC000039796552 |