BIOPEP-UWM: Report
| ID | 10727 |
| Name | Alpha-amylase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-amylase (EC 3.2.1.1) | |||
| Number of residues | 3 |
Activity code | aami |
| Activity : | alpha-amylase inhibitor |
|||
| Chemical mass | 475.4971 | Monoisotopic mass | 475.2173 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Al-Bukhaiti W. Q., Al-Dalali S., Li H., Yao L., Abed S. M., Zhao L., Qiu S.-X. | |
| Title | |
| Identification and in vitro characterization of novel antidiabetic peptides released enzymatically from peanut protein. Plant Foods Hum. Nutr., 79, 66–72, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C21H29N7O6/c22-13(9-17(29)30)18(31)28-16(8-11-10-26-14-5-2-1-4-12(11)14)19(32)27-15(20(33)34)6-3-7-25-21(23)24/h1-2,4-5,10,13,15-16,26H,3,6-9,22H2,(H,27,32)(H,28,31)(H,29,30)(H,33,34)(H4,23,24,25)/t13-,15-,16-/m0/s1 InChIKey=HPDQMSHNSALVNQ-FRSCJGFNSA-N Inhibitor of alpha-glucosidase (EC 3.2.1.20) according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |
| ChEBI: ID 160949 Metabolomics Workbench: ID 80597 PubChem: CID 145454576 |