BIOPEP-UWM: Report
| ID | 10768 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 2 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 146.1441 | Monoisotopic mass | 146.0689 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang R., Zhao Y., Xue W., Xia Y., Liang G. | |
| Title | |
| Novel antioxidant peptides from soybean protein by employ computational and experimental methods and their mechanisms of oxidative stress resistance. J. Mol. Struct., 1318, 139284, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C5H10N2O3/c1-3(5(9)10)7-4(8)2-6/h3H,2,6H2,1H3,(H,7,8)(H,9,10)/t3-/m0/s1 InChIKey=VPZXBVLAVMBEQI-VKHMYHEASA-N Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1)(MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides (ID 7598); the ChEMBL database; the DFBP database; the EROP-Moscow database Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8524); the BRENDA database; the DFBP database Inhibitor of Alanine carboxypeptidase (EC 3.4.17.6) (MEROPS ID: M9E.002) according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |
| ACToR: ID 3695-73-6 AHTPDB: ID 1424, 1685, 3013, 3035, 3057, 3088, 3093, 3128, 3233, 3482, 3802, 3914, 4422, 4508, 4653, 6584 BindingDB: ID 50188530 BioPepDB: ID biopep00319 BIOPEP-UWM database of bioactive peptides: ID 7598; 8524 BRENDA: Ligand Gly-Ala CAS: Registry No 3695-73-6 ChEBI: ID 73855 ChEMBL: ID CHEMBL91241 ChemSpider: ID 1267926 DFBP: ID DFBPACEI1637; DFBPDPIV0129; DFBPMUFU0462 ECHA: ID 223-019-8 EPA CompTox: ID DTXSID501316691 EROP Moscow: ID E10381 FDA SRS: 2M7GF488BL GSRS: ID 2618d861-af53-4b37-af43-4b8c5956d06b J-GLOBAL: ID 200907054642999454 Metabolights: ID MTBLC73855 Metabolomics Workbench: ID 78796 NIAID: ID 335272335276 Nikkaji: ID J139.227A PubChem: CID 1551643 SAPdb: ID 1390; 1931 SATPdb: ID satpdb27196 SureChEMBL: ID SCHEMBL564562 UNII: ID 2M7GF488BL Wikidata: ID Q27144182 ZINC: ID ZINC000001730665 |