BIOPEP-UWM: Report
| ID | 10769 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 434.4849 | Monoisotopic mass | 434.2158 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang R., Zhao Y., Xue W., Xia Y., Liang G. | |
| Title | |
| Novel antioxidant peptides from soybean protein by employ computational and experimental methods and their mechanisms of oxidative stress resistance. J. Mol. Struct., 1318, 139284, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C21H30N4O6/c1-12(2)18(24-17(27)11-22)20(29)25-9-3-4-16(25)19(28)23-15(21(30)31)10-13-5-7-14(26)8-6-13/h5-8,12,15-16,18,26H,3-4,9-11,22H2,1-2H3,(H,23,28)(H,24,27)(H,30,31)/t15-,16-,18-/m0/s1 InChIKey=NFEUTIDGDKBJRG-BQFCYCMXSA-N |
| Database reference: |