BIOPEP-UWM: Report
| ID | 10770 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 2 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 252.2691 | Monoisotopic mass | 252.1219 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang R., Zhao Y., Xue W., Xia Y., Liang G. | |
| Title | |
| Novel antioxidant peptides from soybean protein by employ computational and experimental methods and their mechanisms of oxidative stress resistance. J. Mol. Struct., 1318, 139284, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)O InChI=1S/C11H16N4O3/c16-10(8-2-1-3-13-8)15-9(11(17)18)4-7-5-12-6-14-7/h5-6,8-9,13H,1-4H2,(H,12,14)(H,15,16)(H,17,18)/t8-,9-/m0/s1 InChIKey=BEPSGCXDIVACBU-IUCAKERBSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8856) Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; BIOPEP-UWM database of bioactive peptides (ID 7843); the DFBP database |
| Database reference: |
| AHTPDB: ID 3019, 3076, 3349, 3450, 3577, 4003, 6746 BioPepDB: ID biopep01053 BIOPEP-UWM database of bioactive peptides: ID 7843; 8856 ChEBI: ID 157883 ChemSpider: ID 8032053 DFBP: ID DFBPACEI0849 FeptideDB: ID 7843, 8856 SATPdb: ID satpdb21800 PubChem: CID 9856353 SureChEMBL: ID SCHEMBL18048894 |