BIOPEP-UWM: Report
| ID | 10771 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 2 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 243.3019 | Monoisotopic mass | 243.1578 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang R., Zhao Y., Xue W., Xia Y., Liang G. | |
| Title | |
| Novel antioxidant peptides from soybean protein by employ computational and experimental methods and their mechanisms of oxidative stress resistance. J. Mol. Struct., 1318, 139284, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C11H21N3O3/c12-6-2-1-4-9(11(16)17)14-10(15)8-5-3-7-13-8/h8-9,13H,1-7,12H2,(H,14,15)(H,16,17)/t8-,9-/m0/s1 InChIKey=RVQDZELMXZRSSI-IUCAKERBSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8858) Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database Bitter peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 15) |
| Database reference: |
| AHTPDB: ID 5443 BindingDB: ID 50188505 BioPepDB: ID biopep01057 BIOPEP-UWM database of bioactive peptides: ID 8858 BIOPEP-UWM database of sensory peptides and amino acids: ID 15 BRENDA: Ligand Pro-Lys ChEBI: ID 74792 ChEMBL: ID CHEMBL377325 ChemSpider: ID 7498109 FeptideDB: ID 8858 J-GLOBAL: ID 201207037096316360 Metabolights: ID MTBLC74792 Nikkaji: ID J3.017.783E PubChem: CID 9209431 SATPdb: ID satpdb17074 SureChEMBL: ID SCHEMBL18075734 ZINC: ID ZINC000008076544 |