BIOPEP-UWM: Report
| ID | 10772 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 259.2584 | Monoisotopic mass | 259.1164 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang R., Zhao Y., Xue W., Xia Y., Liang G. | |
| Title | |
| Novel antioxidant peptides from soybean protein by employ computational and experimental methods and their mechanisms of oxidative stress resistance. J. Mol. Struct., 1318, 139284, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C12H20N4O5/c1-7(15-9(17)5-13)11(19)14-6-10(18)16-4-2-3-8(16)12(20)21/h7-8H,2-6,13H2,1H3,(H,14,19)(H,15,17)(H,20,21)/t7-,8-/m0/s1 InChIKey=KDGARKCAKHBEDB-BQBZGAKWSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides (ID 9145) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9145 ChemSpider: ID 10162562 PubChem: CID 11990095 |