BIOPEP-UWM: Report
| ID | 10774 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 7 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 774.9017 | Monoisotopic mass | 774.4262 | |
| IC50 : | 116.06 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen L., Cheng F., Chen H., Shu G. | |
| Title | |
| Preparation and identification of novel angiotensin-I-converting enzyme inhibitory peptides from Moringa oleifera leaf. LWT, 205, 116472, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C37H58N8O10/c1-4-21(2)30(39)36(53)45-18-8-11-29(45)35(52)44-17-7-10-28(44)34(51)40-22(3)31(48)42-26(19-23-12-14-24(47)15-13-23)32(49)43-27(20-46)33(50)41-25(37(54)55)9-5-6-16-38/h12-15,21-22,25-30,46-47H,4-11,16-20,38-39H2,1-3H3,(H,40,51)(H,41,50)(H,42,48)(H,43,49)(H,54,55)/t21-,22-,25-,26-,27-,28-,29-,30-/m0/s1 InChIKey=HMZDUKOYLBCIJN-HBMYHDLGSA-N |
| Database reference: |