BIOPEP-UWM: Report
| ID | 10775 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 5 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 614.7327 | Monoisotopic mass | 614.3740 | |
| IC50 : | 81.25 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen L., Cheng F., Chen H., Shu G. | |
| Title | |
| Preparation and identification of novel angiotensin-I-converting enzyme inhibitory peptides from Moringa oleifera leaf. LWT, 205, 116472, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C27H50N8O8/c1-7-15(6)20(28)24(40)33-17(11-13(2)3)23(39)35-21(14(4)5)25(41)34-18(12-19(36)37)22(38)32-16(26(42)43)9-8-10-31-27(29)30/h13-18,20-21H,7-12,28H2,1-6H3,(H,32,38)(H,33,40)(H,34,41)(H,35,39)(H,36,37)(H,42,43)(H4,29,30,31)/t15-,16-,17-,18-,20-,21-/m0/s1 InChIKey=HCBJOMKDKLHXML-ZKHIMWLXSA-N |
| Database reference: |