BIOPEP-UWM: Report
| ID | 10776 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 5 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 684.8224 | Monoisotopic mass | 684.3624 | |
| IC50 : | 510.67 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen L., Cheng F., Chen H., Shu G. | |
| Title | |
| Preparation and identification of novel angiotensin-I-converting enzyme inhibitory peptides from Moringa oleifera leaf. LWT, 205, 116472, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C38H48N6O6/c39-21-11-10-19-30(38(49)50)41-36(47)33-20-12-22-44(33)37(48)32(25-28-17-8-3-9-18-28)43-35(46)31(24-27-15-6-2-7-16-27)42-34(45)29(40)23-26-13-4-1-5-14-26/h1-9,13-18,29-33H,10-12,19-25,39-40H2,(H,41,47)(H,42,45)(H,43,46)(H,49,50)/t29-,30-,31-,32-,33-/m0/s1 InChIKey=OAFJTBPRQNXODT-ZTTXAYQISA-N |
| Database reference: |