BIOPEP-UWM: Report
| ID | 10790 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 7 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 723.8187 | Monoisotopic mass | 723.4016 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cao J., Xiang B., Dou B., Hu J., Zhang L., Kang X., Lyu M., Wang S. | |
| Title | |
| Novel angiotensin-converting enzyme-inhibitory peptides obtained from Trichiurus lepturus: preparation, identification and potential antihypertensive mechanism. Biomolecules, 14, 581, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)N)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C31H53N11O9/c1-3-17(2)25(40-28(48)21-9-6-14-42(21)23(44)15-37-26(46)18(32)10-11-22(33)43)29(49)38-16-24(45)41-13-5-8-20(41)27(47)39-19(30(50)51)7-4-12-36-31(34)35/h17-21,25H,3-16,32H2,1-2H3,(H2,33,43)(H,37,46)(H,38,49)(H,39,47)(H,40,48)(H,50,51)(H4,34,35,36)/t17-,18-,19-,20-,21-,25-/m0/s1 InChIKey=JIRYFOFMGIBVAK-OEPYWMGDSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides |