BIOPEP-UWM: Report
| ID | 10792 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 652.6948 | Monoisotopic mass | 652.3170 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cao J., Xiang B., Dou B., Hu J., Zhang L., Kang X., Lyu M., Wang S. | |
| Title | |
| Novel angiotensin-converting enzyme-inhibitory peptides obtained from Trichiurus lepturus: preparation, identification and potential antihypertensive mechanism. Biomolecules, 14, 581, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C28H44N8O10/c1-15(24(41)30-13-22(40)36-11-5-8-19(36)28(45)46)32-25(42)17-6-4-10-35(17)21(39)14-31-27(44)23(16(2)37)33-26(43)18-7-3-9-34(18)20(38)12-29/h15-19,23,37H,3-14,29H2,1-2H3,(H,30,41)(H,31,44)(H,32,42)(H,33,43)(H,45,46)/t15-,16+,17-,18-,19-,23-/m0/s1 InChIKey=PDNNLKVLMMGHHL-IZDYBHSSSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides |