BIOPEP-UWM: Report
| ID | 10805 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 761.8415 | Monoisotopic mass | 761.3043 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Jingyun W., Zehao M., Hongyan Y., Xingyu L., Doudou C., Shiling L. | |
| Title | |
| Novel antioxidant peptides from sheep plasma protein hydrolysates: Purification, identification and cytoprotective effects against H2O2-induced oxidative stress. J. Food Sci., 89, 1944-1959, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCSC)C(=O)O InChI=1S/C34H47N7O11S/c1-18(29(46)40-25(34(51)52)13-15-53-2)37-32(49)26-8-5-14-41(26)33(50)24(10-12-28(44)45)39-31(48)23(9-11-27(42)43)38-30(47)21(35)16-19-17-36-22-7-4-3-6-20(19)22/h3-4,6-7,17-18,21,23-26,36H,5,8-16,35H2,1-2H3,(H,37,49)(H,38,47)(H,39,48)(H,40,46)(H,42,43)(H,44,45)(H,51,52)/t18-,21-,23-,24-,25-,26-/m0/s1 InChIKey=MNUXFUXHCLEKSR-QVBFLENTSA-N |
| Database reference: |