BIOPEP-UWM: Report
| ID | 10809 |
| Name | Alanine carboxypeptidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Alanine carboxypeptidase (EC 3.4.17.6) (MEROPS ID: M9E.002) | |||
| Number of residues | 2 |
Activity code | acar |
| Activity : | alanine carboxypeptidase inhibitor |
|||
| Chemical mass | 236.2664 | Monoisotopic mass | 236.1157 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Levy C. C., Goldman P. | |
| Title | |
| Bacterial peptidases. 3. An enzyme specific for N-acyl linkages to alanine. J. Biol. Chem., 244, 4467-4472, 1969 | |
| Year | Source |
| 1969 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C12H16N2O3/c1-8(12(16)17)14-11(15)10(13)7-9-5-3-2-4-6-9/h2-6,8,10H,7,13H2,1H3,(H,14,15)(H,16,17)/t8-,10-/m0/s1 InChIKey=MIDZLCFIAINOQN-WPRPVWTQSA-N Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BindingDB database, the ChEMBL database, the PubChem database Antimicrobial peptide according to the ParaPep database Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 3176) Inhibitor of Dipeptidyl peptidase-III (DPP-III) (EC 3.4.14.4) (MEROPS ID: M49.001) according to the BIOPEP-UWM database of bioactive peptides (ID 9500) |
| Database reference: |
| ACToR: ID 3918-87-4 BindingDB: ID 50139892 BIOPEP-UWM database of bioactive peptides: ID 3176; 9500 BRENDA: Ligand Phe-Ala CAS: Registry No 3918-87-4 ChEBI: ID 73630 ChEMBL: ID CHEMBL429950 ChemIDplus: ID 003918874 ChemSpider: ID 4589716 EPA CompTox: ID DTXSID20192411 EPA DSSTox: ID DTXCID30114902 EROP-Moscow: ID E09222 FooDB: ID FDB112008 HMDB: ID HMDB0028988 J-GLOBAL: ID 200907042170828067 Metabolights: ID MTBLC133146, MTBLC73630 Metabolomics Workbench: ID 78916 Nikkaji: ID J79.876B NMRShiftDB: ID 60023731 ParaPep: ID 1253, 1255 Pharos: Ligand ID DXBTWDFP3SY9 ProbesDrugs: ID PD119123 PubChem: ID 5488196 SATPdb: ID satpdb10337 SureChEMBL: ID SCHEMBL1711543 UniChem: ID 212258 Wikidata: ID Q27142042 ZINC: ID ZINC000001605731 |