BIOPEP-UWM: Report
| ID | 10810 |
| Name | Anti-inflammatory peptide |
| sequence |
| Function: | |||
| Anti-inflammatory | |||
| Number of residues | 7 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 730.8291 | Monoisotopic mass | 730.3308 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Balde A., Ghosh P., Aishwarya P., Vaishnavi V., Nazeer R. A. | |
| Title | |
| Utilization of diamondback puffer (Lagocephalus guentheri) biomass for the production of bioactive oligopeptides and their inflammation suppressing effects in vitro. Biocatal. Agric. Biotechnol., 58, 103155, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)N)C(=O)NCC(=O)O InChI=1S/C30H50N8O11S/c1-16(2)13-20(28(47)33-14-23(40)35-18(6-8-22(32)39)27(46)34-15-25(43)44)37-29(48)21-5-4-11-38(21)30(49)19(7-9-24(41)42)36-26(45)17(31)10-12-50-3/h16-21H,4-15,31H2,1-3H3,(H2,32,39)(H,33,47)(H,34,46)(H,35,40)(H,36,45)(H,37,48)(H,41,42)(H,43,44)/t17-,18-,19-,20-,21-/m0/s1 InChIKey=VSZFXFQRWVUVHD-SXYSDOLCSA-N |
| Database reference: |