BIOPEP-UWM: Report
| ID | 10811 |
| Name | Anti-inflammatory peptide |
| sequence |
| Function: | |||
| Anti-inflammatory | |||
| Number of residues | 4 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 452.5463 | Monoisotopic mass | 452.2739 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Balde A., Ghosh P., Aishwarya P., Vaishnavi V., Nazeer R. A. | |
| Title | |
| Utilization of diamondback puffer (Lagocephalus guentheri) biomass for the production of bioactive oligopeptides and their inflammation suppressing effects in vitro. Biocatal. Agric. Biotechnol., 58, 103155, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C21H36N6O5/c1-11(2)6-15(22)18(28)26-16(7-12(3)4)20(30)27-17(8-14-9-23-10-24-14)19(29)25-13(5)21(31)32/h9-13,15-17H,6-8,22H2,1-5H3,(H,23,24)(H,25,29)(H,26,28)(H,27,30)(H,31,32)/t13-,15-,16-,17-/m0/s1 InChIKey=XFMHRTDIKKMNQS-HJWJTTGWSA-N |
| Database reference: |