BIOPEP-UWM: Report
| ID | 10813 |
| Name | Antibacterial peptide |
| sequence |
| Function: | |||
| Activity against Salmonella | |||
| Number of residues | 12 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 1246.4051 | Monoisotopic mass | 1245.6583 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pimchan T., Tian F., Thumanu K., Rodtong S., Yongsawatdigul J. | |
| Title | |
| Anti-salmonella activity of a novel peptide, KGGDLGLFEPTL, derived from egg yolk hydrolysate. Antibiotics, 13, 19, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)NCC(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C57H91N13O18/c1-30(2)22-37(66-53(83)40(26-47(77)78)64-44(73)28-60-43(72)27-61-49(79)35(59)16-11-12-20-58)50(80)62-29-45(74)63-38(23-31(3)4)51(81)67-39(25-34-14-9-8-10-15-34)52(82)65-36(18-19-46(75)76)56(86)70-21-13-17-42(70)54(84)69-48(33(7)71)55(85)68-41(57(87)88)24-32(5)6/h8-10,14-15,30-33,35-42,48,71H,11-13,16-29,58-59H2,1-7H3,(H,60,72)(H,61,79)(H,62,80)(H,63,74)(H,64,73)(H,65,82)(H,66,83)(H,67,81)(H,68,85)(H,69,84)(H,75,76)(H,77,78)(H,87,88)/t33-,35+,36+,37+,38+,39+,40+,41+,42+,48+/m1/s1 InChIKey=YZKORJFJARFRMH-OZAKWOADSA-N |
| Database reference: |